C17H11NO3S2 — CID 178132394
7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarbaldehyde (PubChem CID 178132394) has the molecular formula C17H11NO3S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarbaldehyde.
| Compound Name | 7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarbaldehyde |
|---|---|
| PubChem CID | 178132394 |
| Molecular Formula | C17H11NO3S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarbaldehyde |
| SMILES | COc1ccc(-n2c3cc(C=O)sc3c3sc(C=O)cc32)cc1 |
| InChI | InChI=1S/C17H11NO3S2/c1-21-11-4-2-10(3-5-11)18-14-6-12(8-19)22-16(14)17-15(18)7-13(9-20)23-17/h2-9H,1H3 |
| InChIKey | FZLKSLJQRYQCCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|