C22H31N3O2 — CID 178132767
morpholin-4-yl-[1-(4-piperidin-4-ylbutyl)indol-3-yl]methanone (PubChem CID 178132767) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is morpholin-4-yl-[1-(4-piperidin-4-ylbutyl)indol-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(4-piperidin-4-ylbutyl)indol-3-yl]methanone |
|---|---|
| PubChem CID | 178132767 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | morpholin-4-yl-[1-(4-piperidin-4-ylbutyl)indol-3-yl]methanone |
| SMILES | O=C(c1cn(CCCCC2CCNCC2)c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C22H31N3O2/c26-22(24-13-15-27-16-14-24)20-17-25(21-7-2-1-6-19(20)21)12-4-3-5-18-8-10-23-11-9-18/h1-2,6-7,17-18,23H,3-5,8-16H2 |
| InChIKey | QMCOFNGZOGNTPE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|