C26H31FN2O — CID 143502496
1-[1-[4-[1-(4-fluorophenyl)azepan-4-yl]butyl]indol-3-yl]ethanone (PubChem CID 143502496) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[1-[4-[1-(4-fluorophenyl)azepan-4-yl]butyl]indol-3-yl]ethanone.
| Compound Name | 1-[1-[4-[1-(4-fluorophenyl)azepan-4-yl]butyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 143502496 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-[1-[4-[1-(4-fluorophenyl)azepan-4-yl]butyl]indol-3-yl]ethanone |
| SMILES | CC(=O)c1cn(CCCCC2CCCN(c3ccc(F)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H31FN2O/c1-20(30)25-19-29(26-10-3-2-9-24(25)26)16-5-4-7-21-8-6-17-28(18-15-21)23-13-11-22(27)12-14-23/h2-3,9-14,19,21H,4-8,15-18H2,1H3 |
| InChIKey | HHQRODMMSOJIAS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|