C12H8F3NO2S — CID 178134082
5-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiophene-2-carbaldehyde (PubChem CID 178134082) has the molecular formula C12H8F3NO2S and a molecular weight of 287.26 g/mol. Its IUPAC name is 5-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 178134082 |
| Molecular Formula | C12H8F3NO2S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 5-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ncccc2OCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H8F3NO2S/c13-12(14,15)7-18-9-2-1-5-16-11(9)10-4-3-8(6-17)19-10/h1-6H,7H2 |
| InChIKey | TXJMCZWBXHJDFA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|