C19H28Cl2N4O4S — CID 178135624
N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-6,7-dichloro-3-methylsulfanylquinoxalin-2-amine (PubChem CID 178135624) has the molecular formula C19H28Cl2N4O4S and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-6,7-dichloro-3-methylsulfanylquinoxalin-2-amine.
| Compound Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-6,7-dichloro-3-methylsulfanylquinoxalin-2-amine |
|---|---|
| PubChem CID | 178135624 |
| Molecular Formula | C19H28Cl2N4O4S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-6,7-dichloro-3-methylsulfanylquinoxalin-2-amine |
| SMILES | CSc1nc2cc(Cl)c(Cl)cc2nc1NCCOCCOCCOCCOCCN |
| InChI | InChI=1S/C19H28Cl2N4O4S/c1-30-19-18(24-16-12-14(20)15(21)13-17(16)25-19)23-3-5-27-7-9-29-11-10-28-8-6-26-4-2-22/h12-13H,2-11,22H2,1H3,(H,23,24) |
| InChIKey | CNQUOGYDKWYMNP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|