About tert-butyl N-methanidylcarbamate;ethane;yttrium
tert-butyl N-methanidylcarbamate;ethane;yttrium (PubChem CID 178136631) has the molecular formula C8H17NO2Y-2
and a molecular weight of 248.13 g/mol. Its IUPAC name is tert-butyl N-methanidylcarbamate;ethane;yttrium.
Molecular Properties
| Compound Name | tert-butyl N-methanidylcarbamate;ethane;yttrium |
| PubChem CID | 178136631 |
| Molecular Formula | C8H17NO2Y-2 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | tert-butyl N-methanidylcarbamate;ethane;yttrium |
| SMILES | [CH2-]C.[CH2-]NC(=O)OC(C)(C)C.[Y] |
| InChI | InChI=1S/C6H12NO2.C2H5.Y/c1-6(2,3)9-5(8)7-4;1-2;/h4H2,1-3H3,(H,7,8);1H2,2H3;/q2*-1; |
| InChIKey | APFZLNOCDKNZSH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-methanidylcarbamate;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methanidylcarbamate;ethane;yttrium?
The IUPAC name of tert-butyl N-methanidylcarbamate;ethane;yttrium (CID 178136631) is tert-butyl N-methanidylcarbamate;ethane;yttrium.
What is the SMILES notation for tert-butyl N-methanidylcarbamate;ethane;yttrium?
The canonical SMILES for tert-butyl N-methanidylcarbamate;ethane;yttrium is [CH2-]C.[CH2-]NC(=O)OC(C)(C)C.[Y].
What is the InChIKey of tert-butyl N-methanidylcarbamate;ethane;yttrium?
The InChIKey is APFZLNOCDKNZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO2.C2H5.Y/c1-6(2,3)9-5(8)7-4;1-2;/h4H2,1-3H3,(H,7,8);1H2,2H3;/q2*-1;.
What are the key properties of tert-butyl N-methanidylcarbamate;ethane;yttrium?
tert-butyl N-methanidylcarbamate;ethane;yttrium has a molecular weight of 248.13 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methanidylcarbamate;ethane;yttrium is sourced from PubChem (CID 178136631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).