C10H18N2 — CID 178136835
(3Z)-3-N-methyl-4-N-propan-2-ylhexa-1,3,5-triene-3,4-diamine (PubChem CID 178136835) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3Z)-3-N-methyl-4-N-propan-2-ylhexa-1,3,5-triene-3,4-diamine.
| Compound Name | (3Z)-3-N-methyl-4-N-propan-2-ylhexa-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 178136835 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3Z)-3-N-methyl-4-N-propan-2-ylhexa-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(NC)=C(\C=C)NC(C)C |
| InChI | InChI=1S/C10H18N2/c1-6-9(11-5)10(7-2)12-8(3)4/h6-8,11-12H,1-2H2,3-5H3/b10-9- |
| InChIKey | JCYCQJWMSHLZGQ-KTKRTIGZSA-N |
| XLogP | 1.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|