C10H20N2 — CID 143106628
(3Z)-3-N-methyl-4-N-propylhexa-1,3,5-triene-3,4-diamine;molecular hydrogen (PubChem CID 143106628) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (3Z)-3-N-methyl-4-N-propylhexa-1,3,5-triene-3,4-diamine;molecular hydrogen.
| Compound Name | (3Z)-3-N-methyl-4-N-propylhexa-1,3,5-triene-3,4-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 143106628 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (3Z)-3-N-methyl-4-N-propylhexa-1,3,5-triene-3,4-diamine;molecular hydrogen |
| SMILES | C=C/C(NC)=C(\C=C)NCCC.[H][H] |
| InChI | InChI=1S/C10H18N2.H2/c1-5-8-12-10(7-3)9(6-2)11-4;/h6-7,11-12H,2-3,5,8H2,1,4H3;1H/b10-9-; |
| InChIKey | PQMOMFWIWNZHLP-KVVVOXFISA-N |
| XLogP | 2.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|