C25H23NO3 — CID 178137483
(E)-1-(2,3-dihydrobenzo[g][1,4]benzodioxin-7-yl)-3-(3-phenylpyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 178137483) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (E)-1-(2,3-dihydrobenzo[g][1,4]benzodioxin-7-yl)-3-(3-phenylpyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydrobenzo[g][1,4]benzodioxin-7-yl)-3-(3-phenylpyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 178137483 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (E)-1-(2,3-dihydrobenzo[g][1,4]benzodioxin-7-yl)-3-(3-phenylpyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/N1CCC(c2ccccc2)C1)c1ccc2cc3c(cc2c1)OCCO3 |
| InChI | InChI=1S/C25H23NO3/c27-23(9-11-26-10-8-21(17-26)18-4-2-1-3-5-18)20-7-6-19-15-24-25(16-22(19)14-20)29-13-12-28-24/h1-7,9,11,14-16,21H,8,10,12-13,17H2/b11-9+ |
| InChIKey | BIOQJICXZCAESE-PKNBQFBNSA-N |
| XLogP | 4.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|