C21H19NO2S — CID 178137171
(E)-1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-(3-phenyl-2,3-dihydropyrrol-1-yl)prop-2-en-1-one (PubChem CID 178137171) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-(3-phenyl-2,3-dihydropyrrol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-(3-phenyl-2,3-dihydropyrrol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 178137171 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (E)-1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-3-(3-phenyl-2,3-dihydropyrrol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/N1C=CC(c2ccccc2)C1)c1ccc2c(c1)SCCO2 |
| InChI | InChI=1S/C21H19NO2S/c23-19(17-6-7-20-21(14-17)25-13-12-24-20)9-11-22-10-8-18(15-22)16-4-2-1-3-5-16/h1-11,14,18H,12-13,15H2/b11-9+ |
| InChIKey | HQGYITBQGLYGSL-PKNBQFBNSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|