C22H37N3O2 — CID 178138494
1-[(E)-2-(3-cyclohexa-1,5-dien-1-ylpropylamino)but-2-enoyl]-5-methylidenepyrrolidine-2-carbaldehyde;ethane;methanamine (PubChem CID 178138494) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-[(E)-2-(3-cyclohexa-1,5-dien-1-ylpropylamino)but-2-enoyl]-5-methylidenepyrrolidine-2-carbaldehyde;ethane;methanamine.
| Compound Name | 1-[(E)-2-(3-cyclohexa-1,5-dien-1-ylpropylamino)but-2-enoyl]-5-methylidenepyrrolidine-2-carbaldehyde;ethane;methanamine |
|---|---|
| PubChem CID | 178138494 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 1-[(E)-2-(3-cyclohexa-1,5-dien-1-ylpropylamino)but-2-enoyl]-5-methylidenepyrrolidine-2-carbaldehyde;ethane;methanamine |
| SMILES | C=C1CCC(C=O)N1C(=O)/C(=C\C)NCCCC1=CCCC=C1.CC.CN |
| InChI | InChI=1S/C19H26N2O2.C2H6.CH5N/c1-3-18(19(23)21-15(2)11-12-17(21)14-22)20-13-7-10-16-8-5-4-6-9-16;2*1-2/h3,5,8-9,14,17,20H,2,4,6-7,10-13H2,1H3;1-2H3;2H2,1H3/b18-3+;; |
| InChIKey | RTFRJISUVMKHFZ-CRLFTPMMSA-N |
| XLogP | 3.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|