C31H34FN3O3 — CID 171103687
(2S)-N-cyclohepta-1,3,5,6-tetraen-1-yl-1-[2-[3-(4-fluorocyclohepta-1,6-dien-1-yl)prop-2-enoylamino]acetyl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyrrolidine-2-carboxamide (PubChem CID 171103687) has the molecular formula C31H34FN3O3 and a molecular weight of 515.63 g/mol. Its IUPAC name is (2S)-N-cyclohepta-1,3,5,6-tetraen-1-yl-1-[2-[3-(4-fluorocyclohepta-1,6-dien-1-yl)prop-2-enoylamino]acetyl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-cyclohepta-1,3,5,6-tetraen-1-yl-1-[2-[3-(4-fluorocyclohepta-1,6-dien-1-yl)prop-2-enoylamino]acetyl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171103687 |
| Molecular Formula | C31H34FN3O3 |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | (2S)-N-cyclohepta-1,3,5,6-tetraen-1-yl-1-[2-[3-(4-fluorocyclohepta-1,6-dien-1-yl)prop-2-enoylamino]acetyl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C=C\C(=C/C)N(C(=O)[C@@H]1CCCN1C(=O)CNC(=O)C=CC1=CCC(F)CC=C1)C1=CC=CC=C=C1 |
| InChI | InChI=1S/C31H34FN3O3/c1-3-5-14-26(4-2)35(27-15-8-6-7-9-16-27)31(38)28-17-11-22-34(28)30(37)23-33-29(36)21-19-24-12-10-13-25(32)20-18-24/h3-8,10,12,14-16,18-19,21,25,28H,1,11,13,17,20,22-23H2,2H3,(H,33,36)/b14-5-,21-19?,26-4+/t25?,28-/m0/s1 |
| InChIKey | NJISOVLYXIDJFU-BVSZEZCGSA-N |
| XLogP | 4.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|