C33H46N4O2 — CID 178139110
N-[(E,2E)-2-ethylidene-3-methyl-4-[[(Z)-prop-1-enyl]iminomethyl]hept-3-enyl]-5-methylidene-1-[(E)-2-(3-phenylpropylamino)but-2-enoyl]pyrrolidine-2-carboxamide (PubChem CID 178139110) has the molecular formula C33H46N4O2 and a molecular weight of 530.76 g/mol. Its IUPAC name is N-[(E,2E)-2-ethylidene-3-methyl-4-[[(Z)-prop-1-enyl]iminomethyl]hept-3-enyl]-5-methylidene-1-[(E)-2-(3-phenylpropylamino)but-2-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(E,2E)-2-ethylidene-3-methyl-4-[[(Z)-prop-1-enyl]iminomethyl]hept-3-enyl]-5-methylidene-1-[(E)-2-(3-phenylpropylamino)but-2-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178139110 |
| Molecular Formula | C33H46N4O2 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | N-[(E,2E)-2-ethylidene-3-methyl-4-[[(Z)-prop-1-enyl]iminomethyl]hept-3-enyl]-5-methylidene-1-[(E)-2-(3-phenylpropylamino)but-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C1CCC(C(=O)NCC(=C/C)/C(C)=C(/C=N/C=C\C)CCC)N1C(=O)/C(=C\C)NCCCc1ccccc1 |
| InChI | InChI=1S/C33H46N4O2/c1-7-15-29(23-34-21-8-2)26(6)28(9-3)24-36-32(38)31-20-19-25(5)37(31)33(39)30(10-4)35-22-14-18-27-16-12-11-13-17-27/h8-13,16-17,21,23,31,35H,5,7,14-15,18-20,22,24H2,1-4,6H3,(H,36,38)/b21-8-,28-9-,29-26+,30-10+,34-23+ |
| InChIKey | QATKJXXZNNRVHG-QNXCZZOPSA-N |
| XLogP | 6.40 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|