C8H7Cl2N3O — CID 178139480
3,5-dichloro-6-methoxy-1-methylpyrazolo[4,3-b]pyridine (PubChem CID 178139480) has the molecular formula C8H7Cl2N3O and a molecular weight of 232.07 g/mol. Its IUPAC name is 3,5-dichloro-6-methoxy-1-methylpyrazolo[4,3-b]pyridine.
| Compound Name | 3,5-dichloro-6-methoxy-1-methylpyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 178139480 |
| Molecular Formula | C8H7Cl2N3O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 3,5-dichloro-6-methoxy-1-methylpyrazolo[4,3-b]pyridine |
| SMILES | COc1cc2c(nc1Cl)c(Cl)nn2C |
| InChI | InChI=1S/C8H7Cl2N3O/c1-13-4-3-5(14-2)7(9)11-6(4)8(10)12-13/h3H,1-2H3 |
| InChIKey | NPCODKMTPDGDOH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|