C14H21N3 — CID 178139886
1,6-dimethylindazole-5-carbonitrile;ethane (PubChem CID 178139886) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,6-dimethylindazole-5-carbonitrile;ethane.
| Compound Name | 1,6-dimethylindazole-5-carbonitrile;ethane |
|---|---|
| PubChem CID | 178139886 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1,6-dimethylindazole-5-carbonitrile;ethane |
| SMILES | CC.CC.Cc1cc2c(cnn2C)cc1C#N |
| InChI | InChI=1S/C10H9N3.2C2H6/c1-7-3-10-9(4-8(7)5-11)6-12-13(10)2;2*1-2/h3-4,6H,1-2H3;2*1-2H3 |
| InChIKey | RWZXXFCBZPYQGG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |