C10H9F3N2 — CID 147922092
1,5-dimethyl-6-(trifluoromethyl)indazole (PubChem CID 147922092) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 1,5-dimethyl-6-(trifluoromethyl)indazole.
| Compound Name | 1,5-dimethyl-6-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 147922092 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1,5-dimethyl-6-(trifluoromethyl)indazole |
| SMILES | Cc1cc2cnn(C)c2cc1C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2/c1-6-3-7-5-14-15(2)9(7)4-8(6)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | IIFSBNRKGXFZFY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |