C15H20N4O — CID 176934323
1-[4-(1,5-dimethylindazol-6-yl)piperazin-1-yl]ethanone (PubChem CID 176934323) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-[4-(1,5-dimethylindazol-6-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(1,5-dimethylindazol-6-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 176934323 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-[4-(1,5-dimethylindazol-6-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc3c(cnn3C)cc2C)CC1 |
| InChI | InChI=1S/C15H20N4O/c1-11-8-13-10-16-17(3)15(13)9-14(11)19-6-4-18(5-7-19)12(2)20/h8-10H,4-7H2,1-3H3 |
| InChIKey | RATZXFUIUJCFNI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |