C31H30ClFO3Si — CID 178142191
2-[tert-butyl(diphenyl)silyl]oxy-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone (PubChem CID 178142191) has the molecular formula C31H30ClFO3Si and a molecular weight of 533.12 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 178142191 |
| Molecular Formula | C31H30ClFO3Si |
| Molecular Weight | 533.12 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone |
| SMILES | CC(C)(C)[Si](OCC(=O)c1ccc(OCc2c(F)cccc2Cl)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30ClFO3Si/c1-31(2,3)37(25-11-6-4-7-12-25,26-13-8-5-9-14-26)36-22-30(34)23-17-19-24(20-18-23)35-21-27-28(32)15-10-16-29(27)33/h4-20H,21-22H2,1-3H3 |
| InChIKey | ARGBDUNLAUTKNA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.12 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|