C15H22ClFO — CID 178142502
1-chloro-2-[(3-ethylcyclobutyl)oxymethyl]-3-fluorobenzene;ethane (PubChem CID 178142502) has the molecular formula C15H22ClFO and a molecular weight of 272.79 g/mol. Its IUPAC name is 1-chloro-2-[(3-ethylcyclobutyl)oxymethyl]-3-fluorobenzene;ethane.
| Compound Name | 1-chloro-2-[(3-ethylcyclobutyl)oxymethyl]-3-fluorobenzene;ethane |
|---|---|
| PubChem CID | 178142502 |
| Molecular Formula | C15H22ClFO |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-chloro-2-[(3-ethylcyclobutyl)oxymethyl]-3-fluorobenzene;ethane |
| SMILES | CC.CCC1CC(OCc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C13H16ClFO.C2H6/c1-2-9-6-10(7-9)16-8-11-12(14)4-3-5-13(11)15;1-2/h3-5,9-10H,2,6-8H2,1H3;1-2H3 |
| InChIKey | NBQSROYNQVWBIK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |