C18H22N2O4S — CID 178144090
methyl 3-[(4-methoxyphenyl)methoxy]-N-(4-methyloxolan-3-yl)-1,2-oxazole-5-carboximidothioate (PubChem CID 178144090) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is methyl 3-[(4-methoxyphenyl)methoxy]-N-(4-methyloxolan-3-yl)-1,2-oxazole-5-carboximidothioate.
| Compound Name | methyl 3-[(4-methoxyphenyl)methoxy]-N-(4-methyloxolan-3-yl)-1,2-oxazole-5-carboximidothioate |
|---|---|
| PubChem CID | 178144090 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | methyl 3-[(4-methoxyphenyl)methoxy]-N-(4-methyloxolan-3-yl)-1,2-oxazole-5-carboximidothioate |
| SMILES | COc1ccc(COc2cc(/C(=N/C3COCC3C)SC)on2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-12-9-22-11-15(12)19-18(25-3)16-8-17(20-24-16)23-10-13-4-6-14(21-2)7-5-13/h4-8,12,15H,9-11H2,1-3H3/b19-18- |
| InChIKey | DYSMMPXXRFUKBY-HNENSFHCSA-N |
| XLogP | 3.41 |
| TPSA | 66.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|