C22H32N2O4S — CID 178143881
methyl N-(4,4-dimethyloxolan-3-yl)-3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;propane (PubChem CID 178143881) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is methyl N-(4,4-dimethyloxolan-3-yl)-3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;propane.
| Compound Name | methyl N-(4,4-dimethyloxolan-3-yl)-3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;propane |
|---|---|
| PubChem CID | 178143881 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | methyl N-(4,4-dimethyloxolan-3-yl)-3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;propane |
| SMILES | CCC.COc1ccc(COc2cc(/C(=N/C3COCC3(C)C)SC)on2)cc1 |
| InChI | InChI=1S/C19H24N2O4S.C3H8/c1-19(2)12-23-11-16(19)20-18(26-4)15-9-17(21-25-15)24-10-13-5-7-14(22-3)8-6-13;1-3-2/h5-9,16H,10-12H2,1-4H3;3H2,1-2H3/b20-18-; |
| InChIKey | IKKKEVWXYPUJHF-GQQUDWLYSA-N |
| XLogP | 5.21 |
| TPSA | 66.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|