C21H34N2O4S — CID 178143985
ethane;methyl 3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;oxolane (PubChem CID 178143985) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is ethane;methyl 3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;oxolane.
| Compound Name | ethane;methyl 3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;oxolane |
|---|---|
| PubChem CID | 178143985 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethane;methyl 3-[(4-methoxyphenyl)methoxy]-1,2-oxazole-5-carboximidothioate;oxolane |
| SMILES | C1CCOC1.CC.CC.[H]/N=C(\SC)c1cc(OCc2ccc(OC)cc2)no1 |
| InChI | InChI=1S/C13H14N2O3S.C4H8O.2C2H6/c1-16-10-5-3-9(4-6-10)8-17-12-7-11(18-15-12)13(14)19-2;1-2-4-5-3-1;2*1-2/h3-7,14H,8H2,1-2H3;1-4H2;2*1-2H3/b14-13-;;; |
| InChIKey | AUCFJAXFFONXIQ-JRYLAINFSA-N |
| XLogP | 5.80 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|