C20H30N2O3 — CID 22922373
(5Z)-5-(dimethylhydrazinylidene)-2-[(4-methoxyphenyl)methoxy]-4,7,7-trimethylcyclohept-3-en-1-ol (PubChem CID 22922373) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (5Z)-5-(dimethylhydrazinylidene)-2-[(4-methoxyphenyl)methoxy]-4,7,7-trimethylcyclohept-3-en-1-ol.
| Compound Name | (5Z)-5-(dimethylhydrazinylidene)-2-[(4-methoxyphenyl)methoxy]-4,7,7-trimethylcyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 22922373 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (5Z)-5-(dimethylhydrazinylidene)-2-[(4-methoxyphenyl)methoxy]-4,7,7-trimethylcyclohept-3-en-1-ol |
| SMILES | COc1ccc(COC2C=C(C)/C(=N\N(C)C)CC(C)(C)C2O)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-14-11-18(25-13-15-7-9-16(24-6)10-8-15)19(23)20(2,3)12-17(14)21-22(4)5/h7-11,18-19,23H,12-13H2,1-6H3/b21-17- |
| InChIKey | ZZJOVVXWUXNQMM-FXBPSFAMSA-N |
| XLogP | 3.24 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|