C16H19NO2 — CID 118372987
6-[(4-methoxyphenyl)methoxy]-2,5-dimethyl-3H-azepine (PubChem CID 118372987) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methoxy]-2,5-dimethyl-3H-azepine.
| Compound Name | 6-[(4-methoxyphenyl)methoxy]-2,5-dimethyl-3H-azepine |
|---|---|
| PubChem CID | 118372987 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 6-[(4-methoxyphenyl)methoxy]-2,5-dimethyl-3H-azepine |
| SMILES | COc1ccc(COC2=CN=C(C)CC=C2C)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-12-4-5-13(2)17-10-16(12)19-11-14-6-8-15(18-3)9-7-14/h4,6-10H,5,11H2,1-3H3 |
| InChIKey | ZJAPACIIWMHXHB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |