C14H9Cl3N2O3 — CID 178146334
5-[[(3,5-dichloro-2-hydroxybenzoyl)amino]methyl]pyridine-2-carbonyl chloride (PubChem CID 178146334) has the molecular formula C14H9Cl3N2O3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 5-[[(3,5-dichloro-2-hydroxybenzoyl)amino]methyl]pyridine-2-carbonyl chloride.
| Compound Name | 5-[[(3,5-dichloro-2-hydroxybenzoyl)amino]methyl]pyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 178146334 |
| Molecular Formula | C14H9Cl3N2O3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-[[(3,5-dichloro-2-hydroxybenzoyl)amino]methyl]pyridine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc(CNC(=O)c2cc(Cl)cc(Cl)c2O)cn1 |
| InChI | InChI=1S/C14H9Cl3N2O3/c15-8-3-9(12(20)10(16)4-8)14(22)19-6-7-1-2-11(13(17)21)18-5-7/h1-5,20H,6H2,(H,19,22) |
| InChIKey | IDESGGXJJKWVDO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|