C17H19ClN2O3 — CID 178146710
5-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-4-hydroxy-3-methylideneoxolan-2-one;ethane (PubChem CID 178146710) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 5-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-4-hydroxy-3-methylideneoxolan-2-one;ethane.
| Compound Name | 5-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-4-hydroxy-3-methylideneoxolan-2-one;ethane |
|---|---|
| PubChem CID | 178146710 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-4-hydroxy-3-methylideneoxolan-2-one;ethane |
| SMILES | C=C1C(=O)OC(c2ccc(Cl)cc2-c2cnn(C)c2)C1O.CC |
| InChI | InChI=1S/C15H13ClN2O3.C2H6/c1-8-13(19)14(21-15(8)20)11-4-3-10(16)5-12(11)9-6-17-18(2)7-9;1-2/h3-7,13-14,19H,1H2,2H3;1-2H3 |
| InChIKey | SFJSJZNDLYHXRP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|