C15H14ClN3O2 — CID 178146760
4-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-3,4-dihydroxy-2-methylidenebutanenitrile (PubChem CID 178146760) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-3,4-dihydroxy-2-methylidenebutanenitrile.
| Compound Name | 4-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-3,4-dihydroxy-2-methylidenebutanenitrile |
|---|---|
| PubChem CID | 178146760 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-[4-chloro-2-(1-methylpyrazol-4-yl)phenyl]-3,4-dihydroxy-2-methylidenebutanenitrile |
| SMILES | C=C(C#N)C(O)C(O)c1ccc(Cl)cc1-c1cnn(C)c1 |
| InChI | InChI=1S/C15H14ClN3O2/c1-9(6-17)14(20)15(21)12-4-3-11(16)5-13(12)10-7-18-19(2)8-10/h3-5,7-8,14-15,20-21H,1H2,2H3 |
| InChIKey | BPWMNVDZOSRLTG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|