C15H14ClIN2O3 — CID 178146699
methyl 4-[4-chloro-2-(1-iodopyrazol-4-yl)phenyl]-4-hydroxy-2-methylidenebutanoate (PubChem CID 178146699) has the molecular formula C15H14ClIN2O3 and a molecular weight of 432.65 g/mol. Its IUPAC name is methyl 4-[4-chloro-2-(1-iodopyrazol-4-yl)phenyl]-4-hydroxy-2-methylidenebutanoate.
| Compound Name | methyl 4-[4-chloro-2-(1-iodopyrazol-4-yl)phenyl]-4-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 178146699 |
| Molecular Formula | C15H14ClIN2O3 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | methyl 4-[4-chloro-2-(1-iodopyrazol-4-yl)phenyl]-4-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(CC(O)c1ccc(Cl)cc1-c1cnn(I)c1)C(=O)OC |
| InChI | InChI=1S/C15H14ClIN2O3/c1-9(15(21)22-2)5-14(20)12-4-3-11(16)6-13(12)10-7-18-19(17)8-10/h3-4,6-8,14,20H,1,5H2,2H3 |
| InChIKey | JMZQBAJMOIGSSY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|