About 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide
3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide (PubChem CID 178147964) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide |
| PubChem CID | 178147964 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCc2cc(=O)[nH]o2)C1 |
| InChI | InChI=1S/C10H15N3O3/c1-7-2-3-13(6-7)10(15)11-5-8-4-9(14)12-16-8/h4,7H,2-3,5-6H2,1H3,(H,11,15)(H,12,14) |
| InChIKey | JYUFATACAHVKFH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide?
The IUPAC name of 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide (CID 178147964) is 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide.
What is the SMILES notation for 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide?
The canonical SMILES for 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide is CC1CCN(C(=O)NCc2cc(=O)[nH]o2)C1.
What is the InChIKey of 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide?
The InChIKey is JYUFATACAHVKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-7-2-3-13(6-7)10(15)11-5-8-4-9(14)12-16-8/h4,7H,2-3,5-6H2,1H3,(H,11,15)(H,12,14).
What are the key properties of 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide?
3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide has a molecular weight of 225.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[(3-oxo-1,2-oxazol-5-yl)methyl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 178147964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).