C25H28ClF4N5O2 — CID 178148476
3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148476) has the molecular formula C25H28ClF4N5O2 and a molecular weight of 541.98 g/mol. Its IUPAC name is 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148476 |
| Molecular Formula | C25H28ClF4N5O2 |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NCCC1=C(NCc2c(F)cccc2Cl)CNCC1 |
| InChI | InChI=1S/C25H28ClF4N5O2/c26-20-2-1-3-21(27)19(20)14-34-22-15-32-11-8-16(22)9-12-33-24(37)35(13-10-25(28,29)30)23(31)17-4-6-18(36)7-5-17/h1-7,31-32,34,36H,8-15H2,(H,33,37)/b31-23+ |
| InChIKey | OZJSMGDCUQFKNI-UQRQXUALSA-N |
| XLogP | 4.90 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|