C20H21ClF3N5O3 — CID 178148868
1-(4-chlorobenzenecarboximidoyl)-3-[2-(4-cyano-4-hydroxycyclohexen-1-yl)-2-iminoethyl]-1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]urea (PubChem CID 178148868) has the molecular formula C20H21ClF3N5O3 and a molecular weight of 471.87 g/mol. Its IUPAC name is 1-(4-chlorobenzenecarboximidoyl)-3-[2-(4-cyano-4-hydroxycyclohexen-1-yl)-2-iminoethyl]-1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]urea.
| Compound Name | 1-(4-chlorobenzenecarboximidoyl)-3-[2-(4-cyano-4-hydroxycyclohexen-1-yl)-2-iminoethyl]-1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 178148868 |
| Molecular Formula | C20H21ClF3N5O3 |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-(4-chlorobenzenecarboximidoyl)-3-[2-(4-cyano-4-hydroxycyclohexen-1-yl)-2-iminoethyl]-1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]urea |
| SMILES | [H]/N=C(\CNC(=O)N(C[C@H](O)C(F)(F)F)/C(=N/[H])c1ccc(Cl)cc1)C1=CCC(O)(C#N)CC1 |
| InChI | InChI=1S/C20H21ClF3N5O3/c21-14-3-1-13(2-4-14)17(27)29(10-16(30)20(22,23)24)18(31)28-9-15(26)12-5-7-19(32,11-25)8-6-12/h1-5,16,26-27,30,32H,6-10H2,(H,28,31)/b26-15+,27-17+/t16-,19?/m0/s1 |
| InChIKey | IEODPIFALJALBV-WXNVVTLHSA-N |
| XLogP | 2.98 |
| TPSA | 144.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|