C25H24ClF3N6O2 — CID 178148870
1-(benzenecarboximidoyl)-3-[2-[3-[(2-chlorophenyl)methylamino]-2-oxo-1H-pyridin-4-yl]-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148870) has the molecular formula C25H24ClF3N6O2 and a molecular weight of 532.95 g/mol. Its IUPAC name is 1-(benzenecarboximidoyl)-3-[2-[3-[(2-chlorophenyl)methylamino]-2-oxo-1H-pyridin-4-yl]-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(benzenecarboximidoyl)-3-[2-[3-[(2-chlorophenyl)methylamino]-2-oxo-1H-pyridin-4-yl]-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148870 |
| Molecular Formula | C25H24ClF3N6O2 |
| Molecular Weight | 532.95 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-(benzenecarboximidoyl)-3-[2-[3-[(2-chlorophenyl)methylamino]-2-oxo-1H-pyridin-4-yl]-2-iminoethyl]-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccccc1)c1cc[nH]c(=O)c1NCc1ccccc1Cl |
| InChI | InChI=1S/C25H24ClF3N6O2/c26-19-9-5-4-8-17(19)14-33-21-18(10-12-32-23(21)36)20(30)15-34-24(37)35(13-11-25(27,28)29)22(31)16-6-2-1-3-7-16/h1-10,12,30-31,33H,11,13-15H2,(H,32,36)(H,34,37)/b30-20+,31-22+ |
| InChIKey | RYIWYXZABSMSMP-XVLSOOQYSA-N |
| XLogP | 5.00 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|