C20H29ClN3O2+ — CID 178150510
tert-butyl 4-[2-chloro-2-(5-cyclopropyl-2-pyridinyl)ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate (PubChem CID 178150510) has the molecular formula C20H29ClN3O2+ and a molecular weight of 378.92 g/mol. Its IUPAC name is tert-butyl 4-[2-chloro-2-(5-cyclopropyl-2-pyridinyl)ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[2-chloro-2-(5-cyclopropyl-2-pyridinyl)ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 178150510 |
| Molecular Formula | C20H29ClN3O2+ |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | tert-butyl 4-[2-chloro-2-(5-cyclopropyl-2-pyridinyl)ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
| SMILES | CC1=[N+](C(=O)OC(C)(C)C)CCN(CC(Cl)c2ccc(C3CC3)cn2)C1 |
| InChI | InChI=1S/C20H29ClN3O2/c1-14-12-23(9-10-24(14)19(25)26-20(2,3)4)13-17(21)18-8-7-16(11-22-18)15-5-6-15/h7-8,11,15,17H,5-6,9-10,12-13H2,1-4H3/q+1 |
| InChIKey | JKOYMZMBOQEGFH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|