About ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide
ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide (PubChem CID 178151141) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide.
Molecular Properties
| Compound Name | ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide |
| PubChem CID | 178151141 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide |
| SMILES | CC.CC(=O)Nc1ncc(S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C9H12N2O3S.C2H6/c1-6-4-8(15(3,13)14)5-10-9(6)11-7(2)12;1-2/h4-5H,1-3H3,(H,10,11,12);1-2H3 |
| InChIKey | ADQFJFBFXQVNGQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide?
The IUPAC name of ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide (CID 178151141) is ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide.
What is the SMILES notation for ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide?
The canonical SMILES for ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide is CC.CC(=O)Nc1ncc(S(C)(=O)=O)cc1C.
What is the InChIKey of ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide?
The InChIKey is ADQFJFBFXQVNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S.C2H6/c1-6-4-8(15(3,13)14)5-10-9(6)11-7(2)12;1-2/h4-5H,1-3H3,(H,10,11,12);1-2H3.
What are the key properties of ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide?
ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide has a molecular weight of 258.34 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(3-methyl-5-methylsulfonyl-2-pyridinyl)acetamide is sourced from PubChem (CID 178151141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).