C15H17NO2S — CID 123499908
2-(3,4-dimethylphenyl)-3-methyl-5-methylsulfonylpyridine (PubChem CID 123499908) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3-methyl-5-methylsulfonylpyridine.
| Compound Name | 2-(3,4-dimethylphenyl)-3-methyl-5-methylsulfonylpyridine |
|---|---|
| PubChem CID | 123499908 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3-methyl-5-methylsulfonylpyridine |
| SMILES | Cc1ccc(-c2ncc(S(C)(=O)=O)cc2C)cc1C |
| InChI | InChI=1S/C15H17NO2S/c1-10-5-6-13(7-11(10)2)15-12(3)8-14(9-16-15)19(4,17)18/h5-9H,1-4H3 |
| InChIKey | IIRNHZPWFURQTD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |