C42H42N4 — CID 158294844
2,3-bis(3,4-dimethylphenyl)-5,8-dimethylquinoxaline;3,5,6,8-tetramethyl-1,10-phenanthroline (PubChem CID 158294844) has the molecular formula C42H42N4 and a molecular weight of 602.83 g/mol. Its IUPAC name is 2,3-bis(3,4-dimethylphenyl)-5,8-dimethylquinoxaline;3,5,6,8-tetramethyl-1,10-phenanthroline.
| Compound Name | 2,3-bis(3,4-dimethylphenyl)-5,8-dimethylquinoxaline;3,5,6,8-tetramethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 158294844 |
| Molecular Formula | C42H42N4 |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 2,3-bis(3,4-dimethylphenyl)-5,8-dimethylquinoxaline;3,5,6,8-tetramethyl-1,10-phenanthroline |
| SMILES | Cc1ccc(-c2nc3c(C)ccc(C)c3nc2-c2ccc(C)c(C)c2)cc1C.Cc1cnc2c(c1)c(C)c(C)c1cc(C)cnc12 |
| InChI | InChI=1S/C26H26N2.C16H16N2/c1-15-9-11-21(13-19(15)5)25-26(22-12-10-16(2)20(6)14-22)28-24-18(4)8-7-17(3)23(24)27-25;1-9-5-13-11(3)12(4)14-6-10(2)8-18-16(14)15(13)17-7-9/h7-14H,1-6H3;5-8H,1-4H3 |
| InChIKey | GLUBFFQUJXUPPT-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|