C10H10F3N3O4S — CID 148921385
N-(2-acetamido-5-methylsulfonyl-3-pyridinyl)-2,2,2-trifluoroacetamide (PubChem CID 148921385) has the molecular formula C10H10F3N3O4S and a molecular weight of 325.27 g/mol. Its IUPAC name is N-(2-acetamido-5-methylsulfonyl-3-pyridinyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-acetamido-5-methylsulfonyl-3-pyridinyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 148921385 |
| Molecular Formula | C10H10F3N3O4S |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2-acetamido-5-methylsulfonyl-3-pyridinyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)Nc1ncc(S(C)(=O)=O)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O4S/c1-5(17)15-8-7(16-9(18)10(11,12)13)3-6(4-14-8)21(2,19)20/h3-4H,1-2H3,(H,16,18)(H,14,15,17) |
| InChIKey | IVVFETWFJMRVBF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |