C25H23ClFN3OS — CID 178151935
[(2S)-6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl]-[1-[4-(2-chlorophenyl)phenyl]azetidin-3-yl]methanone (PubChem CID 178151935) has the molecular formula C25H23ClFN3OS and a molecular weight of 468.00 g/mol. Its IUPAC name is [(2S)-6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl]-[1-[4-(2-chlorophenyl)phenyl]azetidin-3-yl]methanone.
| Compound Name | [(2S)-6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl]-[1-[4-(2-chlorophenyl)phenyl]azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 178151935 |
| Molecular Formula | C25H23ClFN3OS |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [(2S)-6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl]-[1-[4-(2-chlorophenyl)phenyl]azetidin-3-yl]methanone |
| SMILES | C[C@H]1Cc2cc(F)c(SN)cc2N1C(=O)C1CN(c2ccc(-c3ccccc3Cl)cc2)C1 |
| InChI | InChI=1S/C25H23ClFN3OS/c1-15-10-17-11-22(27)24(32-28)12-23(17)30(15)25(31)18-13-29(14-18)19-8-6-16(7-9-19)20-4-2-3-5-21(20)26/h2-9,11-12,15,18H,10,13-14,28H2,1H3/t15-/m0/s1 |
| InChIKey | KTVYZDYYASZXPE-HNNXBMFYSA-N |
| XLogP | 5.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|