C26H31N5O2 — CID 178156977
7-[(1Z)-buta-1,3-dienyl]-6-methyl-2-[6-[5-(oxetan-3-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-3-pyridinyl]-4H-pyrano[4,3-c]pyrazole (PubChem CID 178156977) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-6-methyl-2-[6-[5-(oxetan-3-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-3-pyridinyl]-4H-pyrano[4,3-c]pyrazole.
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-6-methyl-2-[6-[5-(oxetan-3-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-3-pyridinyl]-4H-pyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 178156977 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-6-methyl-2-[6-[5-(oxetan-3-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-3-pyridinyl]-4H-pyrano[4,3-c]pyrazole |
| SMILES | C=C/C=C\C1=C(C)OCc2cn(-c3ccc(N4CCC5CN(C6COC6)CCC54)nc3)nc21 |
| InChI | InChI=1S/C26H31N5O2/c1-3-4-5-23-18(2)33-15-20-14-31(28-26(20)23)21-6-7-25(27-12-21)30-11-8-19-13-29(10-9-24(19)30)22-16-32-17-22/h3-7,12,14,19,22,24H,1,8-11,13,15-17H2,2H3/b5-4- |
| InChIKey | ZSFZZWXVUGSOLI-PLNGDYQASA-N |
| XLogP | 3.57 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|