C18H31N3O — CID 176695712
ethane;5-methyl-1-(5-propan-2-yloxy-2-pyridinyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 176695712) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is ethane;5-methyl-1-(5-propan-2-yloxy-2-pyridinyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | ethane;5-methyl-1-(5-propan-2-yloxy-2-pyridinyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 176695712 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | ethane;5-methyl-1-(5-propan-2-yloxy-2-pyridinyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CC.CC(C)Oc1ccc(N2CCC3CN(C)CCC32)nc1 |
| InChI | InChI=1S/C16H25N3O.C2H6/c1-12(2)20-14-4-5-16(17-10-14)19-9-6-13-11-18(3)8-7-15(13)19;1-2/h4-5,10,12-13,15H,6-9,11H2,1-3H3;1-2H3 |
| InChIKey | WHHFLFZLRCFPJR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |