C23H28N6 — CID 24743685
6-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 24743685) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 6-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 24743685 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 6-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | CN1C[C@H]2CCN(c3ccc(N4CCN(c5ccc(C#N)cn5)CC4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C23H28N6/c1-26-16-19-8-9-29(22(19)17-26)21-5-3-20(4-6-21)27-10-12-28(13-11-27)23-7-2-18(14-24)15-25-23/h2-7,15,19,22H,8-13,16-17H2,1H3/t19-,22+/m1/s1 |
| InChIKey | KRKDQAYZLKOABY-KNQAVFIVSA-N |
| XLogP | 2.42 |
| TPSA | 49.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|