C15H22N4 — CID 170208337
(3aR)-1-(2-cyclopropylpyrimidin-5-yl)-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 170208337) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is (3aR)-1-(2-cyclopropylpyrimidin-5-yl)-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (3aR)-1-(2-cyclopropylpyrimidin-5-yl)-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 170208337 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3aR)-1-(2-cyclopropylpyrimidin-5-yl)-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1CCC2[C@H](CCN2c2cnc(C3CC3)nc2)C1 |
| InChI | InChI=1S/C15H22N4/c1-18-6-5-14-12(10-18)4-7-19(14)13-8-16-15(17-9-13)11-2-3-11/h8-9,11-12,14H,2-7,10H2,1H3/t12-,14?/m1/s1 |
| InChIKey | WBTSWUNICOOVSO-PUODRLBUSA-N |
| XLogP | 1.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |