C14H16N2O3 — CID 178157610
methane;3-methoxy-5-(pyridin-4-ylamino)benzoic acid (PubChem CID 178157610) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is methane;3-methoxy-5-(pyridin-4-ylamino)benzoic acid.
| Compound Name | methane;3-methoxy-5-(pyridin-4-ylamino)benzoic acid |
|---|---|
| PubChem CID | 178157610 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | methane;3-methoxy-5-(pyridin-4-ylamino)benzoic acid |
| SMILES | C.COc1cc(Nc2ccncc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O3.CH4/c1-18-12-7-9(13(16)17)6-11(8-12)15-10-2-4-14-5-3-10;/h2-8H,1H3,(H,14,15)(H,16,17);1H4 |
| InChIKey | FWPHMBRKIWHGRJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |