C8H18N2O4 — CID 178158629
ethane;3-hydroxy-2-(3-hydroxypropanoylamino)propanamide (PubChem CID 178158629) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethane;3-hydroxy-2-(3-hydroxypropanoylamino)propanamide.
| Compound Name | ethane;3-hydroxy-2-(3-hydroxypropanoylamino)propanamide |
|---|---|
| PubChem CID | 178158629 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | ethane;3-hydroxy-2-(3-hydroxypropanoylamino)propanamide |
| SMILES | CC.NC(=O)C(CO)NC(=O)CCO |
| InChI | InChI=1S/C6H12N2O4.C2H6/c7-6(12)4(3-10)8-5(11)1-2-9;1-2/h4,9-10H,1-3H2,(H2,7,12)(H,8,11);1-2H3 |
| InChIKey | FFSXAYXVCFZBNM-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |