C3H9N2O2P — CID 89122191
(2R)-3-hydroxy-2-(phosphanylamino)propanamide (PubChem CID 89122191) has the molecular formula C3H9N2O2P and a molecular weight of 136.09 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-(phosphanylamino)propanamide.
| Compound Name | (2R)-3-hydroxy-2-(phosphanylamino)propanamide |
|---|---|
| PubChem CID | 89122191 |
| Molecular Formula | C3H9N2O2P |
| Molecular Weight | 136.09 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | (2R)-3-hydroxy-2-(phosphanylamino)propanamide |
| SMILES | NC(=O)[C@@H](CO)NP |
| InChI | InChI=1S/C3H9N2O2P/c4-3(7)2(1-6)5-8/h2,5-6H,1,8H2,(H2,4,7)/t2-/m1/s1 |
| InChIKey | CEVGOOWBYJKDFY-UWTATZPHSA-N |
| XLogP | -1.79 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.09 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|