C23H31N2O3+ — CID 178161354
tert-butyl (2S,4R)-4-(1-benzylpyridin-1-ium-4-yl)oxy-2-methylpiperidine-1-carboxylate (PubChem CID 178161354) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-(1-benzylpyridin-1-ium-4-yl)oxy-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-(1-benzylpyridin-1-ium-4-yl)oxy-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161354 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl (2S,4R)-4-(1-benzylpyridin-1-ium-4-yl)oxy-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@H](Oc2cc[n+](Cc3ccccc3)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31N2O3/c1-18-16-21(12-15-25(18)22(26)28-23(2,3)4)27-20-10-13-24(14-11-20)17-19-8-6-5-7-9-19/h5-11,13-14,18,21H,12,15-17H2,1-4H3/q+1/t18-,21+/m0/s1 |
| InChIKey | AQGBCQTUCCRTAG-GHTZIAJQSA-N |
| XLogP | 4.19 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|