C15H31NO4 — CID 178163461
tert-butyl 3-[1-(1-amino-2-methylpropan-2-yl)oxy-2-methylpropan-2-yl]oxypropanoate (PubChem CID 178163461) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl 3-[1-(1-amino-2-methylpropan-2-yl)oxy-2-methylpropan-2-yl]oxypropanoate.
| Compound Name | tert-butyl 3-[1-(1-amino-2-methylpropan-2-yl)oxy-2-methylpropan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 178163461 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | tert-butyl 3-[1-(1-amino-2-methylpropan-2-yl)oxy-2-methylpropan-2-yl]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)CCOC(C)(C)COC(C)(C)CN |
| InChI | InChI=1S/C15H31NO4/c1-13(2,3)20-12(17)8-9-18-15(6,7)11-19-14(4,5)10-16/h8-11,16H2,1-7H3 |
| InChIKey | CMJCSWVOBSMFEC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |