C8H12ClF2N — CID 178165371
3-(3,3-difluorocyclobutylidene)pyrrolidine;hydrochloride (PubChem CID 178165371) has the molecular formula C8H12ClF2N and a molecular weight of 195.64 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutylidene)pyrrolidine;hydrochloride.
| Compound Name | 3-(3,3-difluorocyclobutylidene)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 178165371 |
| Molecular Formula | C8H12ClF2N |
| Molecular Weight | 195.64 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-(3,3-difluorocyclobutylidene)pyrrolidine;hydrochloride |
| SMILES | Cl.FC1(F)CC(=C2CCNC2)C1 |
| InChI | InChI=1S/C8H11F2N.ClH/c9-8(10)3-7(4-8)6-1-2-11-5-6;/h11H,1-5H2;1H |
| InChIKey | HXCVKXZSFUDEPP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.64 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|