C8H14N2O3S — CID 178165981
2-(dimethoxyamino)-1-(2-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 178165981) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-(dimethoxyamino)-1-(2-methyl-1,3-thiazol-5-yl)ethanol.
| Compound Name | 2-(dimethoxyamino)-1-(2-methyl-1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 178165981 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-(dimethoxyamino)-1-(2-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | CON(CC(O)c1cnc(C)s1)OC |
| InChI | InChI=1S/C8H14N2O3S/c1-6-9-4-8(14-6)7(11)5-10(12-2)13-3/h4,7,11H,5H2,1-3H3 |
| InChIKey | GBHOCWATQXZFHV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|