About 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile
2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile (PubChem CID 126983495) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile.
Analyze 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile?
The IUPAC name of 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile (CID 126983495) is 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile.
What is the SMILES notation for 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile?
The canonical SMILES for 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile is COC(C#N)c1cnc(C)s1.
What is the InChIKey of 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile?
The InChIKey is IDTHDZWINGMZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c1-5-9-4-7(11-5)6(3-8)10-2/h4,6H,1-2H3.
What are the key properties of 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile?
2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile has a molecular weight of 168.22 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(2-methyl-1,3-thiazol-5-yl)acetonitrile is sourced from PubChem (CID 126983495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).